2,3,4-TRICHLORONITROBENZENE
- Product Name2,3,4-TRICHLORONITROBENZENE
- CAS17700-09-3
- MFC6H2Cl3NO2
- MW226.44
- EINECS241-705-5
- MOL File17700-09-3.mol
Chemical Properties
| Melting point | 53-56 °C(lit.) |
| Boiling point | 296.2±35.0 °C(Predicted) |
| Density | 1.7193 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| Flash point | >230 °F |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Light yellow to Green |
| Water Solubility | 26.04mg/L(20 ºC) |
| BRN | 2211951 |
| Henry's Law Constant | 1.1×100 mol/(m3Pa) at 25℃, Zhang et al. (2010) |
| InChI | InChI=1S/C6H2Cl3NO2/c7-3-1-2-4(10(11)12)6(9)5(3)8/h1-2H |
| InChIKey | BGKIECJVXXHLDP-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C([N+]([O-])=O)C(Cl)=C1Cl |
| CAS DataBase Reference | 17700-09-3(CAS DataBase Reference) |
| EPA Substance Registry System | 1,2,3-Trichloro-4-nitrobenzene (17700-09-3) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-36/37 |
| RIDADR | UN 1578 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | DA6612000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049095 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | mic-sat 410 mLg/plate MUREAV 116,217,1983 |
