2,4,6-TRICHLORONITROBENZENE
- Product Name2,4,6-TRICHLORONITROBENZENE
- CAS18708-70-8
- MFC6H2Cl3NO2
- MW226.44
- EINECS242-518-1
- MOL File18708-70-8.mol
Chemical Properties
| Melting point | 70-72 °C |
| Boiling point | 303.2±37.0 °C(Predicted) |
| Density | 1.651±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | methanol: 0.1 g/mL, clear |
| form | Solid |
| color | White to Pale Yellow |
| BRN | 2213282 |
| Stability | Stable. Incompatible with strong bases, strong reducing agents, strong oxidizing agents. |
| InChI | 1S/C6H2Cl3NO2/c7-3-1-4(8)6(10(11)12)5(9)2-3/h1-2H |
| InChIKey | AEBJDOTVYMITIA-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1c(Cl)cc(Cl)cc1Cl |
| CAS DataBase Reference | 18708-70-8(CAS DataBase Reference) |
| EPA Substance Registry System | 2,4,6-Trichloronitrobenzene (18708-70-8) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 23/24/25-33 |
| Safety Statements | 28-36/37/39-45 |
| RIDADR | UN 1578 6.1/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2904.99.4700 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 4 STOT RE 2 |
