3-Nitrophenylsulfur pentafluoride
- Product Name3-Nitrophenylsulfur pentafluoride
- CAS2613-26-5
- MFC6H4F5NO2S
- MW249.16
- EINECS447-600-2
- MOL File2613-26-5.mol
Chemical Properties
| Melting point | 0℃ |
| Boiling point | 106 °C2 mm Hg(lit.) |
| Density | 1.665 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| Water Solubility | Difficult to mix in water. |
| BRN | 2699206 |
| InChI | InChI=1S/C6H4F5NO2S/c7-15(8,9,10,11)6-3-1-2-5(4-6)12(13)14/h1-4H |
| InChIKey | FSTNQYCPXJMFMT-UHFFFAOYSA-N |
| SMILES | S(C1C=CC=C(N(=O)=O)C=1)(F)(F)(F)(F)F |
| CAS DataBase Reference | 2613-26-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,T,Xn |
| Risk Statements | 34-36/37-20/22 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Toxic/Irritant |
| TSCA | No |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29309090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 STOT SE 3 |