4-Nitrophenylsulfur pentafluoride
- Product Name4-Nitrophenylsulfur pentafluoride
- CAS2613-27-6
- MFC6H4F5NO2S
- MW249.16
- EINECS447-610-7
- MOL File2613-27-6.mol
Chemical Properties
| Melting point | 38 °C |
| Boiling point | 76-77°C 12mm |
| refractive index | 1.4729 |
| Flash point | 76-77°C/12mm |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | Soluble in acetonitrile |
| Water Solubility | Insoluble in water |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| BRN | 1986023 |
| Henry's Law Constant | 1.6×10-1 mol/(m3Pa) at 25℃, Ebert et al. (2023) |
| InChI | InChI=1S/C6H4F5NO2S/c7-15(8,9,10,11)6-3-1-5(2-4-6)12(13)14/h1-4H |
| InChIKey | AGNCKMHGYZKMLN-UHFFFAOYSA-N |
| SMILES | C1(=CC=C([N+]([O-])=O)C=C1)S(F)(F)(F)(F)F |
| CAS DataBase Reference | 2613-27-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,T |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3261 |
| Hazard Note | Toxic/Irritant |
| TSCA | No |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2929900090 |
