Bis(3-nitrophenyl) disulfide
- Product NameBis(3-nitrophenyl) disulfide
- CAS537-91-7
- MFC12H8N2O4S2
- MW308.34
- EINECS208-677-6
- MOL File537-91-7.mol
Chemical Properties
| Melting point | 78-80 °C(lit.) |
| Boiling point | 443.6±30.0 °C(Predicted) |
| Density | 1.5285 (rough estimate) |
| refractive index | 1.6510 (estimate) |
| solubility | soluble in Tetrahydrofuran |
| form | powder to crystal |
| color | Light yellow to Brown to Dark green |
| Sensitive | Stench |
| Merck | 14,6618 |
| InChI | InChI=1S/C12H8N2O4S2/c15-13(16)9-3-1-5-11(7-9)19-20-12-6-2-4-10(8-12)14(17)18/h1-8H |
| InChIKey | ODOFDWDUSSFUMN-UHFFFAOYSA-N |
| SMILES | S(C1=CC=CC([N+]([O-])=O)=C1)SC1=CC=CC([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 537-91-7(CAS DataBase Reference) |
| EPA Substance Registry System | Disulfide, bis(3-nitrophenyl) (537-91-7) |
Safety Information
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61-24/25 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | JO1550000 |
| Hazard Note | Harmful/Stench |
| TSCA | TSCA listed |
| HS Code | 29309090 |
