| Melting point |
78-80 °C(lit.) |
| Boiling point |
443.6±30.0 °C(Predicted) |
| Density |
1.5285 (rough estimate) |
| refractive index |
1.6510 (estimate) |
| solubility |
Tetrahydrofuran[soluble in] |
| solubility |
soluble in Tetrahydrofuran |
| form |
powder to crystal |
| color |
Light yellow to Brown to Dark green |
| Sensitive |
Stench |
| Merck |
14,6618 |
| InChI |
InChI=1S/C12H8N2O4S2/c15-13(16)9-3-1-5-11(7-9)19-20-12-6-2-4-10(8-12)14(17)18/h1-8H |
| InChIKey |
ODOFDWDUSSFUMN-UHFFFAOYSA-N |
| SMILES |
S(C1=CC=CC([N+]([O-])=O)=C1)SC1=CC=CC([N+]([O-])=O)=C1 |
| CAS DataBase Reference |
537-91-7(CAS DataBase Reference) |
| EPA Substance Registry System |
Disulfide, bis(3-nitrophenyl) (537-91-7) |
