4-(1-Pyrrolidino)benzaldehyde
- Product Name4-(1-Pyrrolidino)benzaldehyde
- CAS51980-54-2
- MFC11H13NO
- MW175.23
- EINECS257-570-0
- MOL File51980-54-2.mol
Chemical Properties
| Melting point | 85 °C |
| Boiling point | 329.4±25.0 °C(Predicted) |
| Density | 1.125±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | 5.68±0.20(Predicted) |
| color | Light yellow to Brown to Dark green |
| Sensitive | Air Sensitive |
| BRN | 135279 |
| InChI | 1S/C11H13NO/c13-9-10-3-5-11(6-4-10)12-7-1-2-8-12/h3-6,9H,1-2,7-8H2 |
| InChIKey | DATXHLPRESKQJK-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1ccc(cc1)N2CCCC2 |
| CAS DataBase Reference | 51980-54-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
