1,1'-Binaphthyl-2,2'-diyl hydrogenphosphate
- Product Name1,1'-Binaphthyl-2,2'-diyl hydrogenphosphate
- CAS35193-63-6
- MFC20H13O4P
- MW348.29
- EINECS252-425-8
- MOL File35193-63-6.mol
Chemical Properties
| Melting point | ≥300 °C |
| Boiling point | 619.5±38.0 °C(Predicted) |
| Density | 1.49±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Solid |
| pka | 1.14±0.20(Predicted) |
| color | White to Yellow to Orange |
| optical activity | Consistent with structure |
| Water Solubility | Extremely low soluble in water. |
| InChI | InChI=1S/C20H13O4P/c21-25(22)23-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)24-25/h1-12H,(H,21,22) |
| InChIKey | JEHUZVBIUCAMRZ-UHFFFAOYSA-N |
| SMILES | O1C2=CC=C3C(=C2C2=C4C(C=CC=C4)=CC=C2OP1(=O)O)C=CC=C3 |
| CAS DataBase Reference | 35193-63-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39-22 |
| WGK Germany | 3 |
| RTECS | RZ2475100 |
| F | 10-23 |
| HS Code | 2931499090 |
| Storage Class | 11 - Combustible Solids |
