| Melting point |
-60 °C |
| Boiling point |
163 °C / 12mmHg |
| Density |
0.88 |
| vapor pressure |
0.019Pa at 20℃ |
| refractive index |
1.4520-1.4560 |
| Flash point |
93 °C |
| storage temp. |
Store at room temperature |
| form |
clear liquid |
| pka |
-0.61±0.70(Predicted) |
| color |
Colorless to Light yellow to Light orange |
| Water Solubility |
4.3mg/L at 20℃ |
| InChI |
InChI=1S/C17H36N2O/c1-5-9-13-18(14-10-6-2)17(20)19(15-11-7-3)16-12-8-4/h5-16H2,1-4H3 |
| InChIKey |
SNDGLCYYBKJSOT-UHFFFAOYSA-N |
| SMILES |
N(CCCC)(CCCC)C(N(CCCC)CCCC)=O |
| LogP |
6.2 at 25℃ |
| CAS DataBase Reference |
4559-86-8(CAS DataBase Reference) |
| NIST Chemistry Reference |
Urea, tetrabutyl-(4559-86-8) |
| EPA Substance Registry System |
Urea, tetrabutyl- (4559-86-8) |
