| Boiling point |
253 °C(lit.) |
| Density |
0.98 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.472(lit.) |
| Flash point |
>230 °F |
| color |
A colourless liquid with a sweet wood like odour of moderate tenacity |
| Odor |
at 100.00 %. herbal linalyl acetate woody pine lavender |
| Odor Type |
herbal |
| InChI |
InChI=1/C13H20O2/c1-9(14)15-7-6-10-4-5-11-8-12(10)13(11,2)3/h4,11-12H,5-8H2,1-3H3/t11-,12-/s3 |
| InChIKey |
AWNOGHRWORTNEI-KBLMMMSONA-N |
| SMILES |
[C@@]12([H])C[C@@]([H])(CC=C1CCOC(=O)C)C2(C)C |&1:0,3,r| |
| LogP |
3.889 (est) |
| EPA Substance Registry System |
Bicyclo[3.1.1]hept-2-ene-2-ethanol, 6,6-dimethyl-, acetate (128-51-8) |
