| Melting point |
235 °C (dec.) (lit.) |
| storage temp. |
Inert atmosphere,Room Temperature |
| form |
Crystalline Powder |
| color |
Light yellow to light pink |
| Water Solubility |
Soluble in water, dichloromethane, acetonitrile, phenyl cyanide, dimethyl formamide, ether, chloroform, alcohol, carbon tetrachloride, acetic acid and carbon disulfide. Sparingly soluble in phenyl chloride, triphenylphosphine and phenyl hydride. Insoluble in aqueous bromine. |
| Sensitive |
Moisture Sensitive |
| BRN |
917652 |
| InChI |
InChI=1S/C18H15Br2P/c19-21(20,16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InChIKey |
OCXGTPDKNBIOTF-UHFFFAOYSA-N |
| SMILES |
P(Br)(Br)(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference |
1034-39-5(CAS DataBase Reference) |
| EPA Substance Registry System |
Phosphorane, dibromotriphenyl- (1034-39-5) |
