5-Fluoro-2-nitrotoluene
- Product Name5-Fluoro-2-nitrotoluene
- CAS446-33-3
- MFC7H6FNO2
- MW155.13
- EINECS207-164-4
- MOL File446-33-3.mol
Chemical Properties
| Melting point | 28°C |
| Boiling point | 97-98 °C/10 mmHg (lit.) |
| Density | 1.272 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 190 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| Specific Gravity | 1.272 |
| BRN | 2046652 |
| InChI | InChI=1S/C7H6FNO2/c1-5-4-6(8)2-3-7(5)9(10)11/h2-4H,1H3 |
| InChIKey | JHFOWEGCZWLHNW-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=CC=C(F)C=C1C |
| CAS DataBase Reference | 446-33-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 4-fluoro-2-methyl-1-nitro-(446-33-3) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-45-37-28A |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049085 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |