5-Fluoro-2-nitrobenzotrifluoride
- Product Name5-Fluoro-2-nitrobenzotrifluoride
- CAS393-09-9
- MFC7H3F4NO2
- MW209.1
- EINECS609-643-7
- MOL File393-09-9.mol
Chemical Properties
| Melting point | 23 °C (lit.) |
| Boiling point | 198-199 °C (lit.) |
| Density | 1.497 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 192 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in chloroform and methanol. |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| Specific Gravity | 1.497 |
| BRN | 3304470 |
| InChI | 1S/C7H3F4NO2/c8-4-1-2-6(12(13)14)5(3-4)7(9,10)11/h1-3H |
| InChIKey | WMQOSURXFLBTPC-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(F)cc1C(F)(F)F |
| CAS DataBase Reference | 393-09-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,F |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37/39 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Flammable/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
