2-Fluoro-5-nitrobenzotrifluoride
- Product Name2-Fluoro-5-nitrobenzotrifluoride
- CAS400-74-8
- MFC7H3F4NO2
- MW209.1
- EINECS206-925-8
- MOL File400-74-8.mol
Chemical Properties
| Melting point | 22-24°C |
| Boiling point | 105-110 °C/25 mmHg (lit.) |
| Density | 1.522 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 197 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| Specific Gravity | 1.522 |
| color | Light yellow to Amber to Dark green |
| BRN | 1881423 |
| InChI | 1S/C7H3F4NO2/c8-6-2-1-4(12(13)14)3-5(6)7(9,10)11/h1-3H |
| InChIKey | DNTHMWUMRGOJRY-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(F)c(c1)C(F)(F)F |
| CAS DataBase Reference | 400-74-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Fluoro-5-nitrobenzotrifluoride(400-74-8) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-23 |
| RIDADR | UN2810 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
