| Melting point |
243-247 °C |
| storage temp. |
2-8°C |
| solubility |
DMF: 11 mg/ml; DMSO: 16 mg/ml; Ethanol: 5 mg/ml; PBS (pH 7.2): 10 mg/ml |
| form |
powder to crystal |
| color |
White to Orange to Green |
| Water Solubility |
Soluble in water, DMSO and methanol. |
| Sensitive |
Hygroscopic |
| Major Application |
pharmaceutical small molecule |
| InChI |
InChI=1S/C10H12Cl2N2.ClH/c11-8-2-1-3-9(10(8)12)14-6-4-13-5-7-14;/h1-3,13H,4-7H2;1H |
| InChIKey |
CYQFNNSFAGXCEC-UHFFFAOYSA-N |
| SMILES |
ClC1C(=CC=CC=1N1CCNCC1)Cl.Cl |
| CAS DataBase Reference |
119532-26-2(CAS DataBase Reference) |
