2,6-Bis(chloromethyl)pyridine
- Product Name2,6-Bis(chloromethyl)pyridine
- CAS3099-28-3
- MFC7H7Cl2N
- MW176.04
- EINECS
- MOL File3099-28-3.mol
Chemical Properties
| Melting point | 73-78 °C (lit.) |
| Boiling point | 110 °C / 3mmHg |
| Density | 1.275±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | 2.19±0.24(Predicted) |
| color | White to Almost white |
| BRN | 116355 |
| InChI | InChI=1S/C7H7Cl2N/c8-4-6-2-1-3-7(5-9)10-6/h1-3H,4-5H2 |
| InChIKey | IWQNFYRJSVJWQA-UHFFFAOYSA-N |
| SMILES | C1(CCl)=NC(CCl)=CC=C1 |
| CAS DataBase Reference | 3099-28-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |