2,2':6',2''-Terpyridine
- Product Name2,2':6',2''-Terpyridine
- CAS1148-79-4
- MFC15H11N3
- MW233.27
- EINECS214-559-5
- MOL File1148-79-4.mol
Chemical Properties
| Melting point | 90-93 °C |
| Boiling point | 370 °C |
| Density | 1.1901 (rough estimate) |
| refractive index | 1.5610 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | dioxane: 0.1 g/mL, clear |
| pka | 4.60±0.10(Predicted) |
| form | Crystalline powder |
| color | Cream to yellow to brown |
| Water Solubility | 1.472g/L(24.99 ºC) |
| BRN | 11199 |
| InChI | InChI=1S/C15H11N3/c1-3-10-16-12(6-1)14-8-5-9-15(18-14)13-7-2-4-11-17-13/h1-11H |
| InChIKey | DRGAZIDRYFYHIJ-UHFFFAOYSA-N |
| SMILES | C1(C2=NC(C3=NC=CC=C3)=CC=C2)=NC=CC=C1 |
| CAS DataBase Reference | 1148-79-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2,2':6',2''-Terpyridine (1148-79-4) |
Safety Information
| Hazard Codes | T+,T |
| Risk Statements | 27/28-37/38-41 |
| Safety Statements | 26-28-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | I |
| HS Code | 29333990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |