6-BROMO-2,2'-BIPYRIDINE
- Product Name6-BROMO-2,2'-BIPYRIDINE
- CAS10495-73-5
- MFC10H7BrN2
- MW235.08
- EINECS
- MOL File10495-73-5.mol
Chemical Properties
| Melting point | 72.0 to 76.0 °C |
| Boiling point | 133°C/2.2mmHg(lit.) |
| Density | 1.493±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform, Methanol |
| form | powder to crystal |
| pka | 3.70±0.22(Predicted) |
| color | White to Almost white |
| BRN | 130238 |
| InChI | InChI=1S/C10H7BrN2/c11-10-6-3-5-9(13-10)8-4-1-2-7-12-8/h1-7H |
| InChIKey | NCRIDSGPLISUEU-UHFFFAOYSA-N |
| SMILES | C1(C2=NC=CC=C2)=NC(Br)=CC=C1 |
| CAS DataBase Reference | 10495-73-5 |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |