2,4-Difluorocinnamic acid
- Product Name2,4-Difluorocinnamic acid
- CAS94977-52-3
- MFC9H6F2O2
- MW184.14
- EINECS
- MOL File94977-52-3.mol
Chemical Properties
| Melting point | 216-218 °C (lit.) |
| Boiling point | 272.0±25.0 °C(Predicted) |
| Density | 1.3056 (estimate) |
| storage temp. | Storage temp. 2-8°C |
| form | powder to crystal |
| pka | 4.29±0.13(Predicted) |
| color | White to Light yellow |
| InChI | 1S/C9H6F2O2/c10-7-3-1-6(8(11)5-7)2-4-9(12)13/h1-5H,(H,12,13)/b4-2+ |
| InChIKey | PQDXPFJQTKGTFP-DUXPYHPUSA-N |
| SMILES | [H]\C(=C(\[H])c1ccc(F)cc1F)C(O)=O |
| CAS DataBase Reference | 94977-52-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-26/37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |