3,5-Difluorocinnamic acid
- Product Name3,5-Difluorocinnamic acid
- CAS147700-58-1
- MFC9H6F2O2
- MW184.14
- EINECS
- MOL File147700-58-1.mol
Chemical Properties
| Melting point | 204-205 °C (lit.) |
| Boiling point | 272.0±25.0 °C(Predicted) |
| Density | 1.379±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.15±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C9H6F2O2/c10-7-3-6(1-2-9(12)13)4-8(11)5-7/h1-5H,(H,12,13)/b2-1+ |
| InChIKey | MBAWRXICVNIUGY-OWOJBTEDSA-N |
| SMILES | C(O)(=O)/C=C/C1=CC(F)=CC(F)=C1 |
| CAS DataBase Reference | 147700-58-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
