2'-Hydroxy-4',6'-dimethoxyacetophenone
- Product Name2'-Hydroxy-4',6'-dimethoxyacetophenone
- CAS90-24-4
- MFC10H12O4
- MW196.2
- EINECS201-978-3
- MOL File90-24-4.mol
Chemical Properties
| Melting point | 80-84 °C(lit.) |
| Boiling point | 185°C/20mm |
| Density | 1.172±0.06 g/cm3(Predicted) |
| Flash point | 185°C/20mm |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Soluble in hot methanol. |
| pka | 9.41±0.15(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| Merck | 14,10067 |
| BRN | 1285013 |
| Stability | Stable under recommended storage conditions., Stable Under Recommended Storage C |
| InChI | 1S/C10H12O4/c1-6(11)10-8(12)4-7(13-2)5-9(10)14-3/h4-5,12H,1-3H3 |
| InChIKey | FBUBVLUPUDBFME-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c(C(C)=O)c(OC)c1 |
| LogP | 2.933 (est) |
| CAS DataBase Reference | 90-24-4(CAS DataBase Reference) |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |