2-Methoxy-6-methylaniline
- Product Name2-Methoxy-6-methylaniline
- CAS50868-73-0
- MFC8H11NO
- MW137.18
- EINECS
- MOL File50868-73-0.mol
Chemical Properties
| Melting point | 26-29 °C (lit.) |
| Boiling point | 62 °C/0.15 mmHg (lit.) |
| Density | 1.0630 (rough estimate) |
| refractive index | 1.5647 (estimate) |
| Flash point | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Sparingly) |
| form | Solid |
| pka | 4.39±0.10(Predicted) |
| color | Clear Brown Oil to Pale Red to Dark Red |
| InChI | InChI=1S/C8H11NO/c1-6-4-3-5-7(10-2)8(6)9/h3-5H,9H2,1-2H3 |
| InChIKey | HKOJYPPTIPJZAZ-UHFFFAOYSA-N |
| SMILES | C1(N)=C(C)C=CC=C1OC |
| CAS DataBase Reference | 50868-73-0 |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2922290090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
