5-Methoxy-2-methylaniline
- Product Name5-Methoxy-2-methylaniline
- CAS50868-72-9
- MFC8H11NO
- MW137.18
- EINECS256-816-4
- MOL File50868-72-9.mol
Chemical Properties
| Melting point | 43-46 °C (lit.) |
| Boiling point | 253°C(lit.) |
| Density | 1.0630 (rough estimate) |
| refractive index | 1.5647 (estimate) |
| Flash point | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Powder |
| pka | 4.03±0.10(Predicted) |
| color | Off-white to pale grey to yellow |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C8H11NO/c1-6-3-4-7(10-2)5-8(6)9/h3-5H,9H2,1-2H3 |
| InChIKey | RPJXLEZOFUNGNZ-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(OC)=CC=C1C |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |