4-Chloro-3-nitroanisole
- Product Name4-Chloro-3-nitroanisole
- CAS10298-80-3
- MFC7H6ClNO3
- MW187.58
- EINECS233-674-1
- MOL File10298-80-3.mol
Chemical Properties
| Melting point | 41-43 °C (lit.) |
| Boiling point | 293°C |
| Density | 1.366 |
| refractive index | 1.6000 (estimate) |
| Flash point | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Amber |
| BRN | 640872 |
| InChI | InChI=1S/C7H6ClNO3/c1-12-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
| InChIKey | HISHUMDTGXICEZ-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(OC)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 10298-80-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | BZ8580000 |
| Hazard Note | Irritant |
| HS Code | 29093090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |