2-Chloro-4-(trifluoromethyl)benzenesulfonyl chloride
- Product Name2-Chloro-4-(trifluoromethyl)benzenesulfonyl chloride
- CAS175205-54-6
- MFC7H3Cl2F3O2S
- MW279.06
- EINECS
- MOL File175205-54-6.mol
Chemical Properties
| Melting point | 37-39°C |
| Boiling point | 70-71 °C/0.5 mmHg (lit.) |
| Density | 1.597 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| color | Light orange to Yellow to Green |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C7H3Cl2F3O2S/c8-5-3-4(7(10,11)12)1-2-6(5)15(9,13)14/h1-3H |
| InChIKey | NJXDBSSSDPOAFI-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(c(Cl)c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 175205-54-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34-43 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B Skin Sens. 1 |