4-Chloro-3-(trifluoromethyl)benzenesulfonyl chloride
- Product Name4-Chloro-3-(trifluoromethyl)benzenesulfonyl chloride
- CAS32333-53-2
- MFC7H3Cl2F3O2S
- MW279.06
- EINECS672-518-0
- MOL File32333-53-2.mol
Chemical Properties
| Melting point | 28 °C |
| Boiling point | 83-84°C/0.1mm |
| Density | 1.626±0.06 g/cm3(Predicted) |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C7H3Cl2F3O2S/c8-6-2-1-4(15(9,13)14)3-5(6)7(10,11)12/h1-3H |
| InChIKey | SSULGNXFUGLULI-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC=C(Cl)C(C(F)(F)F)=C1 |
| CAS DataBase Reference | 32333-53-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C,Xi |
| Risk Statements | 34-36 |
| Safety Statements | 26-36/37/39-45-27 |
| RIDADR | 3261 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
