3-(Trifluoromethoxy)benzenesulfonyl chloride
- Product Name3-(Trifluoromethoxy)benzenesulfonyl chloride
- CAS220227-84-9
- MFC7H4ClF3O3S
- MW260.62
- EINECS624-326-3
- MOL File220227-84-9.mol
Chemical Properties
| Melting point | 229-230℃ |
| Boiling point | 229-230 °C(lit.) |
| Density | 1.530 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C7H4ClF3O3S/c8-15(12,13)6-3-1-2-5(4-6)14-7(9,10)11/h1-4H |
| InChIKey | DODDSXTWDSJCDN-UHFFFAOYSA-N |
| SMILES | FC(F)(F)Oc1cccc(c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 220227-84-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-39-37-36 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2909309090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
