3,5-Bis(trifluoromethyl)benzenesulfonyl chloride
- Product Name3,5-Bis(trifluoromethyl)benzenesulfonyl chloride
- CAS39234-86-1
- MFC8H3ClF6O2S
- MW312.62
- EINECS254-371-0
- MOL File39234-86-1.mol
Chemical Properties
| Melting point | 34-38 °C(lit.) |
| Boiling point | 70°C 2mm |
| Density | 1.618±0.06 g/cm3(Predicted) |
| Flash point | 228 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | soluble in Toluene |
| form | powder to lump |
| color | White to Orange to Green |
| Sensitive | Hygroscopic |
| BRN | 3621218 |
| InChI | InChI=1S/C8H3ClF6O2S/c9-18(16,17)6-2-4(7(10,11)12)1-5(3-6)8(13,14)15/h1-3H |
| InChIKey | BTRCVKADYDVSLI-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 39234-86-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Bis(trifluoromethyl)benzenesulfonyl chloride(39234-86-1) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Hygroscopic |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |