2-Chloro-4-(trifluoromethyl)benzenesulfonyl chloride
- Product Name2-Chloro-4-(trifluoromethyl)benzenesulfonyl chloride
- CAS175205-54-6
- CBNumberCB0678324
- MFC7H3Cl2F3O2S
- MW279.06
- MDL NumberMFCD00052912
- MOL File175205-54-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 37-39°C |
| Boiling point | 70-71 °C/0.5 mmHg (lit.) |
| Density | 1.597 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| color | Light orange to Yellow to Green |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C7H3Cl2F3O2S/c8-5-3-4(7(10,11)12)1-2-6(5)15(9,13)14/h1-3H |
| InChIKey | NJXDBSSSDPOAFI-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(c(Cl)c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 175205-54-6(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H318-H314-H317-H290 | |||||||||
| Precautionary statements | P280-P305+P351+P338-P310-P234-P260-P264-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501-P309 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34-43 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 3265 8/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Corrosive | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29049090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B Skin Sens. 1 | |||||||||
| NFPA 704: |
|
