Basic Brown 1
- Product NameBasic Brown 1
- CAS10114-58-6
- MFC18H19ClN8
- MW382.86
- EINECS233-314-3
- MOL File10114-58-6.mol
Chemical Properties
| Melting point | >200 ℃ |
| storage temp. | Flammables area |
| solubility | Soluble in water, methyl cellosolve, ethylene glycol; slightly soluble in ethanol; insoluble in acetone, benzene, carbon tetrachloride, xylene |
| pka | 5.0(at 25℃) |
| Colour Index | 21000 |
| form | powder |
| color | Blackish-brown or red-brown |
| Water Solubility | Soluble |
| λmax | 457 nm |
| Merck | 14,1253 |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents, reducing agents. |
| Biological Applications | Differential inhibition of brain specific binding |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C18H18N8.2ClH/c19-11-4-6-17(15(21)8-11)25-23-13-2-1-3-14(10-13)24-26-18-7-5-12(20)9-16(18)22;;/h1-10H,19-22H2;2*1H/b25-23+,26-24+;; |
| InChIKey | MCZVRBLCRZWFJH-SPBSJSFYSA-N |
| SMILES | Cl.Cl.Nc1ccc(\N=N\c2cccc(c2)\N=N\c3ccc(N)cc3N)c(N)c1 |
| CAS DataBase Reference | 10114-58-6(CAS DataBase Reference) |
| EPA Substance Registry System | C.I. Basic Brown 1, dihydrochloride (10114-58-6) |
Safety Information
| Hazard Codes | Xn-F,Xn,F |
| Risk Statements | 20/21/22-11-36/37/38 |
| Safety Statements | 22-24/25-36/37/39-26-16-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 32041300 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |
