| Melting point |
<-10°C |
| Boiling point |
230℃[at 101 325 Pa] |
| Density |
1.222 g/mL at 25 °C |
| vapor pressure |
0.51 psi ( 20 °C) |
| refractive index |
n20/D 1.438 |
| Flash point |
118 °F |
| form |
Liquid |
| Specific Gravity |
1.21 |
| color |
Colorless to Light orange to Yellow |
| Water Solubility |
Miscible with water. |
| Hydrolytic Sensitivity |
0: forms stable aqueous solutions |
| InChI |
InChI=1S/2C3H5O3.2H3N.2H2O.Ti/c2*1-2(4)3(5)6;;;;;/h2*2H,1H3,(H,5,6);2*1H3;2*1H2;/q2*-1;;;;;+4/p-2 |
| InChIKey |
XRASGLNHKOPXQL-UHFFFAOYSA-L |
| SMILES |
[Ti](O)(O)(OC(C)C(=O)O)OC(C)C(=O)O.N.N |
| LogP |
-0.69 at 25℃ |
| CAS DataBase Reference |
65104-06-5 |
| EPA Substance Registry System |
Titanate(2-), dihydroxybis[2-(hydroxy-.kappa.O)propanoato(2-)-.kappa.O]-, diammonium (65104-06-5) |
