Dihydroxybis(ammonium lactato)titanium(IV)
- Product NameDihydroxybis(ammonium lactato)titanium(IV)
- CAS65104-06-5
- CBNumberCB0466011
- MFC6H18N2O8Ti
- MW294.08
- EINECS265-409-0
- MDL NumberMFCD00072736
- MOL File65104-06-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | <-10°C |
| Boiling point | 230℃[at 101 325 Pa] |
| Density | 1.222 g/mL at 25 °C |
| vapor pressure | 0.51 psi ( 20 °C) |
| refractive index | n |
| Flash point | 118 °F |
| form | Liquid |
| Specific Gravity | 1.21 |
| color | Colorless to Light orange to Yellow |
| Water Solubility | Miscible with water. |
| Hydrolytic Sensitivity | 0: forms stable aqueous solutions |
| InChI | InChI=1S/2C3H5O3.2H3N.2H2O.Ti/c2*1-2(4)3(5)6;;;;;/h2*2H,1H3,(H,5,6);2*1H3;2*1H2;/q2*-1;;;;;+4/p-2 |
| InChIKey | XRASGLNHKOPXQL-UHFFFAOYSA-L |
| SMILES | [Ti](O)(O)(OC(C)C(=O)O)OC(C)C(=O)O.N.N |
| LogP | -0.69 at 25℃ |
| CAS DataBase Reference | 65104-06-5 |
| EPA Substance Registry System | Titanate(2-), dihydroxybis[2-(hydroxy-.kappa.O)propanoato(2-)-.kappa.O]-, diammonium (65104-06-5) |
| UNSPSC Code | 12161600 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226 | |||||||||
| Precautionary statements | P210-P233-P240-P241-P242-P243 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 10-36 | |||||||||
| Safety Statements | 16-26-36 | |||||||||
| RIDADR | UN 1993 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2931.90.9051 | |||||||||
| HazardClass | 3 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Flam. Liq. 3 | |||||||||
| NFPA 704: |
|