2,2-Dimethoxy-2-phenylacetophenone
- Product Name2,2-Dimethoxy-2-phenylacetophenone
- CAS24650-42-8
- MFC16H16O3
- MW256.3
- EINECS246-386-6
- MOL File24650-42-8.mol
Chemical Properties
| Melting point | 67-70 °C(lit.) |
| Boiling point | 169°C 7mm |
| Density | 1.1320 (rough estimate) |
| vapor pressure | 0.002Pa at 25℃ |
| refractive index | 1.5590 (estimate) |
| Flash point | 190 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | methylene chloride: 20 mg/mL, clear |
| form | Crystalline Powder |
| color | White to pale yellow |
| Water Solubility | 66.32mg/L at 25℃ |
| BRN | 2054295 |
| Stability | Stable, but light-sensitive. Combustible. Incompatible with strong acids, strong oxidizing agents. |
| Cosmetics Ingredients Functions | FRAGRANCE |
| InChI | 1S/C16H16O3/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12H,1-2H3 |
| InChIKey | KWVGIHKZDCUPEU-UHFFFAOYSA-N |
| SMILES | COC(OC)(C(=O)c1ccccc1)c2ccccc2 |
| LogP | 2.95 at 25℃ |
Safety Information
| Hazard Codes | Xi,N |
| Risk Statements | 43-50/53 |
| Safety Statements | 36/37-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | KM5775658 |
| F | 8 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 STOT RE 2 |