Diphenyldiethoxysilane
- Product NameDiphenyldiethoxysilane
- CAS2553-19-7
- MFC16H20O2Si
- MW272.41
- EINECS219-860-5
- MOL File2553-19-7.mol
Chemical Properties
| Boiling point | 167 °C15 mm Hg(lit.) |
| Density | 1.033 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| form | liquid |
| Specific Gravity | 1.033 |
| color | Colorless to Almost colorless |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 2281302 |
| InChI | InChI=1S/C16H20O2Si/c1-3-17-19(18-4-2,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3 |
| InChIKey | ZZNQQQWFKKTOSD-UHFFFAOYSA-N |
| SMILES | [Si](C1=CC=CC=C1)(C1=CC=CC=C1)(OCC)OCC |
| CAS DataBase Reference | 2553-19-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Silane, diethoxydiphenyl-(2553-19-7) |
| EPA Substance Registry System | Silane, diethoxydiphenyl- (2553-19-7) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
