Tetraphenylsilane
- Product NameTetraphenylsilane
- CAS1048-08-4
- MFC24H20Si
- MW336.5
- EINECS213-881-3
- MOL File1048-08-4.mol
Chemical Properties
| Melting point | 236 °C |
| Boiling point | 228 °C |
| Density | 1.078 |
| Flash point | 193°C |
| storage temp. | Store at room temperature |
| form | solid |
| Specific Gravity | 1.078 |
| color | White to Almost white |
| Water Solubility | Insoluble in water. |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| BRN | 1885911 |
| InChI | InChI=1S/C24H20Si/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H |
| InChIKey | JLAVCPKULITDHO-UHFFFAOYSA-N |
| SMILES | [Si](C1=CC=CC=C1)(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference | 1048-08-4(CAS DataBase Reference) |
| EPA Substance Registry System | Silane, tetraphenyl- (1048-08-4) |
Safety Information
| Safety Statements | 22-24/25 |
| TSCA | TSCA listed |
| HS Code | 29319090 |
