4-Cyano-3-fluorophenylboronic acid
- Product Name4-Cyano-3-fluorophenylboronic acid
- CAS843663-18-3
- MFC7H5BFNO2
- MW164.93
- EINECS
- MOL File843663-18-3.mol
Chemical Properties
| Melting point | 362-366 |
| Boiling point | 354.4±52.0 °C(Predicted) |
| Density | 1.35±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 6.30±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C7H5BFNO2/c9-7-3-6(8(11)12)2-1-5(7)4-10/h1-3,11-12H |
| InChIKey | DECWLXUOZUMPBF-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C#N)C(F)=C1)(O)O |
| CAS DataBase Reference | 843663-18-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-22 |
| Safety Statements | 26-36/37/39-24/25 |
| RIDADR | 3439 |
| WGK Germany | WGK 3 |
| Hazard Note | Harmhul/Keep Cold |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |