| Melting point |
86°C |
| Boiling point |
290.72°C (rough estimate) |
| Density |
1.3286 (rough estimate) |
| refractive index |
1.5081 (estimate) |
| storage temp. |
2-8°C |
| solubility |
Soluble[in water] |
| Water Solubility |
Soluble in water |
| form |
powder to crystal |
| pka |
-0.47±0.30(Predicted) |
| color |
White to Light yellow to Light red |
| Sensitive |
Hygroscopic |
| InChI |
InChI=1S/C8H10O3S/c1-6-3-4-7(2)8(5-6)12(9,10)11/h3-5H,1-2H3,(H,9,10,11) |
| InChIKey |
IRLYGRLEBKCYPY-UHFFFAOYSA-N |
| SMILES |
C1(S(O)(=O)=O)=CC(C)=CC=C1C |
| CAS DataBase Reference |
609-54-1(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzenesulfonic acid, 2,5-dimethyl- (609-54-1) |
