3-Bromo-2-hydroxybenzaldehyde
- Product Name3-Bromo-2-hydroxybenzaldehyde
- CAS1829-34-1
- MFC7H5BrO2
- MW201.02
- EINECS627-478-9
- MOL File1829-34-1.mol
Chemical Properties
| Melting point | 53-57 |
| Boiling point | 215.6±20.0 °C(Predicted) |
| Density | 1.737±0.06 g/cm3(Predicted) |
| Flash point | >110 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 6?+-.0.10(Predicted) |
| color | Light yellow to Amber to Dark green |
| InChI | InChI=1S/C7H5BrO2/c8-6-3-1-2-5(4-9)7(6)10/h1-4,10H |
| InChIKey | STBGLXMINLWCNL-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=CC(Br)=C1O |
| CAS DataBase Reference | 1829-34-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HS Code | 29130000 |
