4-Bromo-2-hydroxybenzaldehyde
- Product Name4-Bromo-2-hydroxybenzaldehyde
- CAS22532-62-3
- MFC7H5BrO2
- MW201.02
- EINECS636-586-5
- MOL File22532-62-3.mol
Chemical Properties
| Melting point | 50-54 °C |
| Boiling point | 48-52 °C(Press: 0.04 Torr) |
| Density | 1.737±0.06 g/cm3(Predicted) |
| Flash point | 110 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in methanol. |
| form | powder to crystal |
| pka | 7.21±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C7H5BrO2/c8-6-2-1-5(4-9)7(10)3-6/h1-4,10H |
| InChIKey | HXTWKHXDFATMSP-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(Br)C=C1O |
| CAS DataBase Reference | 22532-62-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 22-50 |
| Safety Statements | 60 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 9 |
| HS Code | 2913000090 |
