4-Bromo-2-hydroxybenzaldehyde
- Product Name4-Bromo-2-hydroxybenzaldehyde
- CAS22532-62-3
- CBNumberCB7373442
- MFC7H5BrO2
- MW201.02
- EINECS636-586-5
- MDL NumberMFCD06252606
- MOL File22532-62-3.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 50-54 °C |
| Boiling point | 48-52 °C(Press: 0.04 Torr) |
| Density | 1.737±0.06 g/cm3(Predicted) |
| Flash point | 110 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in methanol. |
| form | powder to crystal |
| pka | 7.21±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C7H5BrO2/c8-6-2-1-5(4-9)7(10)3-6/h1-4,10H |
| InChIKey | HXTWKHXDFATMSP-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(Br)C=C1O |
| CAS DataBase Reference | 22532-62-3(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H410 | |||||||||
| Precautionary statements | P264-P270-P273-P301+P312-P391-P501 | |||||||||
| Hazard Codes | Xi,N,Xn | |||||||||
| Risk Statements | 22-50 | |||||||||
| Safety Statements | 60 | |||||||||
| RIDADR | UN 3077 9/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | 9 | |||||||||
| HS Code | 2913000090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 | |||||||||
| NFPA 704: |
|
