2-Hydroxy-4-methylquinoline
- Product Name2-Hydroxy-4-methylquinoline
- CAS607-66-9
- MFC10H9NO
- MW159.18
- EINECS210-139-0
- MOL File607-66-9.mol
Chemical Properties
| Melting point | 221-223 °C (lit.) |
| Boiling point | 284.68°C (rough estimate) |
| Density | 1.1202 (rough estimate) |
| refractive index | 1.6070 (estimate) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 11.83±0.70(Predicted) |
| color | White to Almost white |
| BRN | 118331 |
| InChI | InChI=1S/C10H9NO/c1-7-6-10(12)11-9-5-3-2-4-8(7)9/h2-6H,1H3,(H,11,12) |
| InChIKey | APLVPBUBDFWWAD-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(C)=CC1=O |
| CAS DataBase Reference | 607-66-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-22-36/37/39 |
| WGK Germany | 3 |
| HS Code | 29334990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
