2-Ethyl-4-methyl-1H-imidazole-1-propanenitrile
- Product Name2-Ethyl-4-methyl-1H-imidazole-1-propanenitrile
- CAS23996-25-0
- MFC9H13N3
- MW163.22
- EINECS245-975-5
- MOL File23996-25-0.mol
Chemical Properties
| Melting point | 11 °C |
| Boiling point | 245-246 °C (lit.) |
| Density | 0.950 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 7.76±0.60(Predicted) |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C9H13N3/c1-3-9-11-8(2)7-12(9)6-4-5-10/h7H,3-4,6H2,1-2H3 |
| InChIKey | UIDDPPKZYZTEGS-UHFFFAOYSA-N |
| SMILES | C1(CC)N(CCC#N)C=C(C)N=1 |
| CAS DataBase Reference | 23996-25-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-(2-Cyanoethyl)-2-ethyl-4-methylimidazole(23996-25-0) |
| EPA Substance Registry System | 1H-Imidazole-1-propanenitrile, 2-ethyl-4-methyl- (23996-25-0) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 25-37/38-41 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2933.29.9000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
