cis-3-Hexenyl lactate
- Product Namecis-3-Hexenyl lactate
- CAS61931-81-5
- MFC9H16O3
- MW172.22
- EINECS263-337-4
- MOL File61931-81-5.mol
Chemical Properties
| Boiling point | 71 °C0.7 mm Hg(lit.) |
| Density | 0.982 g/mL at 25 °C(lit.) |
| FEMA | 3690 | CIS-3-HEXENYL LACTATE |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Store at room temperature, keep dry and cool |
| pka | 13.03±0.20(Predicted) |
| Specific Gravity | 0.984 |
| Appearance | Colorless to light yellow Liquid |
| Odor | at 100.00 %. green leafy sweet melon waxy violet leaf tropical fruity |
| Odor Type | green |
| biological source | Mentha spicata L. |
| JECFA Number | 934 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C9H16O3/c1-3-4-5-6-7-12-9(11)8(2)10/h4-5,8,10H,3,6-7H2,1-2H3/b5-4- |
| InChIKey | NNLLMULULOBXBY-PLNGDYQASA-N |
| SMILES | [H]\C(CC)=C(/[H])CCOC(=O)C(C)O |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29181100 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |