2-(1-Methyl-5-nitro-1H-imidazol-2-yl)-propan-2-ol
- Product Name2-(1-Methyl-5-nitro-1H-imidazol-2-yl)-propan-2-ol
- CAS35175-14-5
- MFC7H11N3O3
- MW185.18
- EINECS233-305-4
- MOL File35175-14-5.mol
Chemical Properties
| Melting point | 108-110°C |
| Boiling point | 367.7±22.0 °C(Predicted) |
| Density | 1.34±0.1 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 13.44±0.29(Predicted) |
| color | Yellow to Orange |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | 1S/C7H11N3O3/c1-7(2,11)6-8-4-5(9(6)3)10(12)13/h4,11H,1-3H3 |
| InChIKey | DTHPMNDYKOSVFR-UHFFFAOYSA-N |
| SMILES | Cn1c(cnc1C(C)(C)O)[N+]([O-])=O |
Safety Information
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
