Chemical Properties
| Melting point | 197°C(dec.)(lit.) |
| Boiling point | 749.7±60.0 °C(Predicted) |
| Density | 1.54±0.1 g/cm3 (20 ºC 760 Torr) |
| solubility | Soluble in methanol; |
| pka | 12.75±0.70(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | insoluble in water |
| InChIKey | IDZZECHGWAZTIB-NYBIBFQCSA-N |
| SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO[C@@H]3OC[C@@H]([C@@H]([C@H]3O)O)O)O)O)O)Oc2c(ccc(c2)OC)C(=O)C |
| CAS DataBase Reference | 72520-92-4 |
Safety Information
| WGK Germany | WGK 3 |
| HS Code | 2940.00.6000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
