Pomolic acid
- Product NamePomolic acid
- CAS13849-91-7
- MFC30H48O4
- MW472.7
- EINECS
- MOL File13849-91-7.mol
Chemical Properties
| Melting point | 297-299 °C(Solv: chloroform (67-66-3); methanol (67-56-1)) |
| Boiling point | 586.2±50.0 °C(Predicted) |
| Density | 1.14±0.1 g/cm3(Predicted) |
| storage temp. | 4°C, protect from light |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 4.48±0.70(Predicted) |
| color | White to off-white |
| biological source | plant |
| Water Solubility | water: slightly soluble |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChIKey | ZZTYPLSBNNGEIS-OPAXANQDSA-N |
| SMILES | O[C@]1([C@@H]2[C@@](CC[C@]3([C@]4([C@@H]([C@@]5([C@H](C([C@H](CC5)O)(C)C)CC4)C)CC=C32)C)C)(CC[C@H]1C)C(=O)O)C |
