1-Cbz-4-Piperidone
- Product Name 1-Cbz-4-Piperidone
- CAS19099-93-5
- MFC13H15NO3
- MW233.26
- EINECS606-227-7
- MOL File19099-93-5.mol
Chemical Properties
| Melting point | 45 °C |
| Boiling point | 170 °C/2 mmHg |
| Density | 1.172 g/mL at 25 °C (lit.) |
| refractive index | 1.54 |
| Flash point | 113 °C - closed cup |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform, Dichloromethane, Ethyl Acetate, Methanol |
| pka | -1.63±0.20(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| Specific Gravity | 1.185 |
| BRN | 1533716 |
| InChI | InChI=1S/C13H15NO3/c15-12-6-8-14(9-7-12)13(16)17-10-11-4-2-1-3-5-11/h1-5H,6-10H2 |
| InChIKey | VZOVOHRDLOYBJX-UHFFFAOYSA-N |
| SMILES | N1(C(OCC2=CC=CC=C2)=O)CCC(=O)CC1 |
| CAS DataBase Reference | 19099-93-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 23-24/25-36-26-37/39 |
| WGK Germany | 3 |
| HS Code | 2933399090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 |