Betamethasone Dipropionate
- Product NameBetamethasone Dipropionate
- CAS5593-20-4
- MFC28H37FO7
- MW504.6
- EINECS227-005-2
- MOL File5593-20-4.mol
Chemical Properties
| Melting point | 178 °C |
| alpha | D26 +65.7° (dioxane) |
| Boiling point | 603.2±55.0 °C(Predicted) |
| Density | 1.1481 (estimate) |
| refractive index | 69 ° (C=1, Dioxane) |
| storage temp. | 2-8°C |
| solubility | Practically insoluble in water, freely soluble in acetone and in methylene chloride, sparingly soluble in ethanol (96 per cent). |
| form | Solid |
| pka | 12.87±0.70(Predicted) |
| color | White to Pale Yellow |
| Merck | 1180 |
| InChIKey | CIWBQSYVNNPZIQ-JCOVECCMSA-N |
| SMILES | C([C@]1([C@H](C[C@@]2([H])[C@]3([H])CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]12C)C)OC(=O)CC)(=O)COC(=O)CC |&1:1,2,4,6,16,18,20,23,r| |
| CAS DataBase Reference | 5593-20-4(CAS DataBase Reference) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 2 |
| RTECS | TU4058000 |
| HS Code | 29372290 |
| Toxicity | LD50 ipr-mus: 103 mg/kg NIIRDN 6,753,82 |
