| Melting point |
290 °C (dec.)(lit.) |
| alpha |
-135 º (c=5, 0.05 M NaOH) |
| Boiling point |
504.93°C (rough estimate) |
| Density |
1.2112 (rough estimate) |
| bulk density |
100kg/m3 |
| refractive index |
-135 ° (C=0.5, JP Method) |
| Flash point |
9℃ |
| storage temp. |
2-8°C |
| solubility |
Very slightly soluble in water, practically insoluble in ethanol (96 per cent). Solutions deteriorate on exposure to light, especially in the presence of alkali. It shows polymorphism (5.9). |
| form |
Powder |
| pka |
1.7(at 25℃) |
| color |
Yellow to orange |
| Odor |
Slight odour |
| PH Range |
6 |
| PH |
5.5-7.2 (0.07g/l, H2O, 20°C) |
| biological source |
synthetic |
| optical activity |
[α]/D -135.0 to -155.0°, c =0.5% in 0.05 M NaOH (dry basis) |
| Water Solubility |
0.07 g/L (20 ºC) |
| Sensitive |
Light Sensitive |
| Merck |
14,8200 |
| BRN |
97825 |
| BCS Class |
1 |
| Stability |
Stable, but light-sensitive. Incompatible with strong oxidizing agents, reducing agents, bases, calcium, metallic salts. May be moisture sensitive. |
| Cosmetics Ingredients Functions |
SKIN CONDITIONING - MISCELLANEOUS
COLORANT |
| InChI |
1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27)/t11-,12+,14-/m0/s1 |
| InChIKey |
AUNGANRZJHBGPY-SCRDCRAPSA-N |
| SMILES |
CC1=C(C)C=C(N(C[C@H](O)[C@@H]([C@H](O)CO)O)C(C2=N3)=NC(NC2=O)=O)C3=C1 |
| LogP |
-2.009 (est) |
| CAS DataBase Reference |
83-88-5(CAS DataBase Reference) |
| NIST Chemistry Reference |
Riboflavine(83-88-5) |
| EPA Substance Registry System |
Riboflavin (83-88-5) |
