| Melting point |
83-86 °C(lit.) |
| alpha |
105 º (c=0.8, EtOH 25 ºC) |
| Boiling point |
451.27°C (rough estimate) |
| Density |
0.9717 (rough estimate) |
| vapor pressure |
2.0 x l0-6 Pa (20 °C, est.) |
| refractive index |
1.5100 (estimate) |
| Flash point |
14 °C |
| storage temp. |
-20°C |
| solubility |
Practically insoluble in water, freely soluble in ethanol (96 per cent), soluble in trimethylpentane and in fatty oils. It is sensitive to air, heat and light. Solutions in solvents without an antioxidant are unstable and are to be used immediately. A reversible isomerisation to pre-cholecalciferol takes place in solution, depending on temperature and time. The activity is due to both compounds. |
| pka |
14.74±0.20(Predicted) |
| form |
powder |
| color |
White |
| Odor |
odorless |
| biological source |
synthetic (organic) |
| Water Solubility |
<0.1 g/L (20 ºC) |
| Sensitive |
Air & Light Sensitive |
| Merck |
14,10019 |
| BRN |
2339331 |
| Stability |
Light Sensitive, Temperature Sensitive |
| Major Application |
food and beverages |
| Cosmetics Ingredients Functions |
ORAL CARE SKIN CONDITIONING - MISCELLANEOUS |
| InChIKey |
QYSXJUFSXHHAJI-YRZJJWOYSA-N |
| SMILES |
CC(C)CCC[C@@H](C)[C@@]1([H])CC[C@@]([C@]1(C)CCC/2)([H])C2=C\C=C(C[C@@H](O)CC3)/C3=C |
| LogP |
9.085 (est) |
| CAS DataBase Reference |
67-97-0(CAS DataBase Reference) |
| NIST Chemistry Reference |
Cholecalciferol(67-97-0) |
| EPA Substance Registry System |
Cholecalciferol (67-97-0) |