| Melting point |
110-112°; mp 183° |
| alpha |
D20 +63° (c = 0.1 in ethanol) |
| Boiling point |
640.7±55.0 °C(Predicted) |
| Density |
1.25±0.1 g/cm3(Predicted) |
| storage temp. |
Refrigerator |
| solubility |
Practically insoluble in water, freely soluble in acetone and in ethanol (96 per cent), sparingly soluble in propylene glycol. It shows polymorphism (5.9). |
| form |
Solid |
| pka |
14.05±0.70(Predicted) |
| color |
White to Off-White |
| InChIKey |
FNPXMHRZILFCKX-IVRISGIPNA-N |
| SMILES |
[C@@]1(OC(=O)OCC)(C(=O)COC(=O)CC)CC[C@@]2([H])[C@]3([H])CCC4=CC(=O)C=C[C@]4(C)[C@@]3([H])[C@@H](O)C[C@]12C |&1:0,17,19,29,31,33,36,r| |
